CAS 1452577-03-5 is the registry number for 4-(pyrrolidin-1-ylmethyl)phenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
[4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid;hydrochloride (CAS 1452577-03-5) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: [4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid;hydrochloride. InChIKey: DKKSCNVZSQKJLA-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | [4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid;hydrochloride |
| InChIKey | DKKSCNVZSQKJLA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN2CCCC2)(O)O.Cl |
Computed by PubChem (NCBI)