Products 1452577-03-5

CAS 1452577-03-5 is the registry number for 4-(pyrrolidin-1-ylmethyl)phenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

[4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid;hydrochloride (CAS 1452577-03-5) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: [4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid;hydrochloride. InChIKey: DKKSCNVZSQKJLA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17BClNO2
Molecular weight241.52 g/mol
IUPAC name[4-(pyrrolidin-1-ylmethyl)phenyl]boronic acid;hydrochloride
InChIKeyDKKSCNVZSQKJLA-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)CN2CCCC2)(O)O.Cl

Computed by PubChem (NCBI)