CAS 1310147-83-1 is the registry number for (4-(Piperidin-1-yl)phenyl)boronic acid hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
(4-piperidin-1-ylphenyl)boronic acid;hydrochloride (CAS 1310147-83-1) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: (4-piperidin-1-ylphenyl)boronic acid;hydrochloride. InChIKey: XJTAVEWPXXNWGK-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | (4-piperidin-1-ylphenyl)boronic acid;hydrochloride |
| InChIKey | XJTAVEWPXXNWGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCCCC2)(O)O.Cl |
Computed by PubChem (NCBI)