Products 1704074-24-7
CAS 1704074-24-7 is the registry number for (3–Chloro–4–((diethylamino)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-chloro-4-(diethylaminomethyl)phenyl]boronic acid (CAS 1704074-24-7) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: [3-chloro-4-(diethylaminomethyl)phenyl]boronic acid. InChIKey: RCCXAZJHSWFDDD-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | [3-chloro-4-(diethylaminomethyl)phenyl]boronic acid |
| InChIKey | RCCXAZJHSWFDDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN(CC)CC)Cl)(O)O |
Computed by PubChem (NCBI)