CAS 850567-43-0 appears in our catalog under these names: 3-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)aniline hydrochloride, 95+%, 95+%, 3-(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)ANILINE HYDROCHLORIDE, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline;hydrochloride (CAS 850567-43-0) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline;hydrochloride. InChIKey: YQYGZJXWLKFOIA-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)aniline;hydrochloride |
| InChIKey | YQYGZJXWLKFOIA-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)