Products 1704074-37-2
CAS 1704074-37-2 is the registry number for (4–Chloro–3–((diethylamino)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-chloro-3-(diethylaminomethyl)phenyl]boronic acid (CAS 1704074-37-2) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: [4-chloro-3-(diethylaminomethyl)phenyl]boronic acid. InChIKey: OMMXUCYVSJQDKO-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | [4-chloro-3-(diethylaminomethyl)phenyl]boronic acid |
| InChIKey | OMMXUCYVSJQDKO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)CN(CC)CC)(O)O |
Computed by PubChem (NCBI)