cas: 83528-16-9 — see every product listed under this CAS number, including other names
(4-Amino-phenyl)-acetic acid methyl ester HCl, 98%, 98% (CAS 83528-16-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3T9-5g |
| cas | 83528-16-9 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 798.80 Pln | |
| Chemat | 25g | 1864.40 Pln | |
| Chemat | 100g | 4922.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4-aminophenyl)acetate;hydrochloride (CAS 83528-16-9) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 2-(4-aminophenyl)acetate;hydrochloride. InChIKey: WRZBLDDHUMBLKP-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl 2-(4-aminophenyl)acetate;hydrochloride |
| InChIKey | WRZBLDDHUMBLKP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)