Products 83528-16-9
CAS 83528-16-9 appears in our catalog under these names: (4-Amino-phenyl)-acetic acid methyl ester hydrochloride, 98%, Methyl 2-(4-aminophenyl)acetate hydrochloride, 96%, (4-Amino-phenyl)-acetic acid methyl ester hydrochloride, (4-Amino-phenyl)-acetic acid methyl ester HCl, 98%, 98%, (4-Amino-phenyl)-acetic acid methyl ester hydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
Methyl 2-(4-aminophenyl)acetate;hydrochloride (CAS 83528-16-9) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 2-(4-aminophenyl)acetate;hydrochloride. InChIKey: WRZBLDDHUMBLKP-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl 2-(4-aminophenyl)acetate;hydrochloride |
| InChIKey | WRZBLDDHUMBLKP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl (4-aminophenyl)acetate--hydrogen chloride (1/1), methyl 2-(4-aminophenyl)acetate hydrochloride, (4-Amino-phenyl)-acetic acid methyl ester HCl, methyl 2-(4-aminophenyl)acetate;hydrochloride, 4-amino-benzeneacetic acid methyl ester hcl, Methyl2-(4-aminophenyl)acetatehydrochloride, methyl 4-aminophenylacetate hydrochloride, (4-amino-phenyl)-acetic acid methyl ester hydrochloride, WRZBLDDHUMBLKP-UHFFFAOYSA-N, 4-Amino-benzeneacetic acid methyl ester hydrochloride