CAS 14963-34-9 appears in our catalog under these names: 4-Amino-4'-hydroxybenzophenone, 4-Amino-4'-hydroxybenzophenone, 95%, 95%, (4-Aminophenyl)(4-hydroxyphenyl)methanone, ≥95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
(4-aminophenyl)-(4-hydroxyphenyl)methanone (CAS 14963-34-9) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: (4-aminophenyl)-(4-hydroxyphenyl)methanone. InChIKey: ZLUJJCPTVKQVDE-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | (4-aminophenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | ZLUJJCPTVKQVDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)O)N |
Computed by PubChem (NCBI)