CAS 18714-17-5 appears in our catalog under these names: 4-Phenylpyridine-2-carboxylic acid methyl ester, 96%, Methyl 4-phenylpicolinate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 4-phenylpyridine-2-carboxylate (CAS 18714-17-5) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 4-phenylpyridine-2-carboxylate. InChIKey: YXRDMGUQHSRTEQ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 4-phenylpyridine-2-carboxylate |
| InChIKey | YXRDMGUQHSRTEQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)