CAS 10177-13-6 appears in our catalog under these names: Methyl 5-phenylnicotinate, 98%, Methyl 5–phenylnicotinate, Methyl 5-phenylnicotinate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 5-phenylpyridine-3-carboxylate (CAS 10177-13-6) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 5-phenylpyridine-3-carboxylate. InChIKey: CJXJQNNSSJBPBF-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 5-phenylpyridine-3-carboxylate |
| InChIKey | CJXJQNNSSJBPBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)