CAS 90395-47-4 appears in our catalog under these names: Methyl 4-(3-pyridinyl)benzoate, 95%, Methyl 4-(3-pyridyl)benzoate, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 1g, 5g, 2,5g, 10g, 25g, 50g.
Methyl 4-pyridin-3-ylbenzoate (CAS 90395-47-4) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 4-pyridin-3-ylbenzoate. InChIKey: SMXKPSLCRALELV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 4-pyridin-3-ylbenzoate |
| InChIKey | SMXKPSLCRALELV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)