CAS 79601-27-7 is the registry number for Methyl 3-(3-pyridinyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-pyridin-3-ylbenzoate (CAS 79601-27-7) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 3-pyridin-3-ylbenzoate. InChIKey: HLFKAFNNGCVRIQ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 3-pyridin-3-ylbenzoate |
| InChIKey | HLFKAFNNGCVRIQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)