Products 5447-47-2

CAS 5447-47-2 appears in our catalog under these names: 2,3-Dihydro-1h-cyclopenta[b]quinoline-9-carboxylic acid, 95%, 2,3-Dihydro-1H-cyclopenta(b)quinoline-9-carboxylic acid, 95+%, 2,3-Dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid, 95%, 95%, 2,3-Dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 50mg, 100mg, 500mg, 10g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid (CAS 5447-47-2) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid. InChIKey: YHLOYZLGFGTCEB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO2
Molecular weight213.23 g/mol
IUPAC name2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxylic acid
InChIKeyYHLOYZLGFGTCEB-UHFFFAOYSA-N
SMILESC1CC2=C(C3=CC=CC=C3N=C2C1)C(=O)O

Computed by PubChem (NCBI)