CAS 98061-21-3 appears in our catalog under these names: Methyl 4-(2-pyridinyl)benzoate, 95%, 4-Pyridin-2-yl-benzoic acid methyl ester, 95-<97%, Methyl 4-(2-pyridinyl)benzoate, 95+%. Offered by: Combi-blocks, Hoffman Fine Chemicals, AmBeed. Available pack sizes: 1g, 250mg, 2,5g, 5g, 10g, 25g, 50g.
Methyl 4-pyridin-2-ylbenzoate (CAS 98061-21-3) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 4-pyridin-2-ylbenzoate. InChIKey: WNUOEXYOJHXGAX-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 4-pyridin-2-ylbenzoate |
| InChIKey | WNUOEXYOJHXGAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)