cas: 1106676-82-7 — see every product listed under this CAS number, including other names
(4-Bromo-2,5-difluorophenyl)boronic acid 98% (CAS 1106676-82-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A840851-250mg |
| cas | 1106676-82-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 320.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A840851 |
(4-bromo-2,5-difluorophenyl)boronic acid (CAS 1106676-82-7) is a chemical compound with the molecular formula C6H4BBrF2O2 and a molecular weight of 236.81 g/mol. IUPAC name: (4-bromo-2,5-difluorophenyl)boronic acid. InChIKey: RWBIJRFCSHAOGQ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrF2O2 |
|---|---|
| Molecular weight | 236.81 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenyl)boronic acid |
| InChIKey | RWBIJRFCSHAOGQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Br)F)(O)O |
Computed by PubChem (NCBI)