cas: 5525-40-6 — see every product listed under this CAS number, including other names
(4-Bromophenyl)diphenylphosphine oxide, 95% (CAS 5525-40-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F541673-1G |
| cas | 5525-40-6 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 305.12 Pln | |
| Fluorochem | 25g | 653.95 Pln | |
| Fluorochem | 100g | 2299.21 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 429.20 Pln | |
| Chemat | 100g | 1533.20 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one (CAS 5525-40-6) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: 2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one. InChIKey: PHBAXBAJPLNXRV-UHFFFAOYSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one |
| InChIKey | PHBAXBAJPLNXRV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)