cas: 5525-40-6 — see every product listed under this CAS number, including other names
(4-Bromophenyl)diphenylphosphine oxide, 97% (CAS 5525-40-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g. Offered by: Combi-blocks, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QW-2255-25g |
| cas | 5525-40-6 |
| size | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 770.88 Pln | |
| Ambeed | 100g | 2389.56 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 231.05 Pln | |
| BLDpharm | 10g | 369.89 Pln | |
| BLDpharm | 25g | 825.29 Pln | |
| BLDpharm | 100g | 2569.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one (CAS 5525-40-6) is a chemical compound with the molecular formula C21H17NO and a molecular weight of 299.4 g/mol. IUPAC name: 2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one. InChIKey: PHBAXBAJPLNXRV-UHFFFAOYSA-N.
| Molecular formula | C21H17NO |
|---|---|
| Molecular weight | 299.4 g/mol |
| IUPAC name | 2,4-diphenyl-7,8-dihydro-6H-quinolin-5-one |
| InChIKey | PHBAXBAJPLNXRV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)C(=CC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)