(4-Butoxyphenyl)boronic acid 98%
cas: 105365-51-3 — see every product listed under this CAS number, including other names
(4-Butoxyphenyl)boronic acid 98% (CAS 105365-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A220016-1g |
| cas | 105365-51-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1193.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A220016 |
(4-butoxyphenyl)boronic acid (CAS 105365-51-3) is a chemical compound with the molecular formula C10H15BO3 and a molecular weight of 194.04 g/mol. IUPAC name: (4-butoxyphenyl)boronic acid. InChIKey: QUPFQMXWFNJUNJ-UHFFFAOYSA-N.
| Molecular formula | C10H15BO3 |
|---|---|
| Molecular weight | 194.04 g/mol |
| IUPAC name | (4-butoxyphenyl)boronic acid |
| InChIKey | QUPFQMXWFNJUNJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Butoxyphenylboronic acid, 4-n-Butoxyphenylboronic acid, (4-butoxyphenyl)boronic Acid, (4-n-Butoxyphenyl)boronic acid, B-(4-Butoxyphenyl)boronic acid, 4-n-Butoxybenzeneboronic acid, Boronic acid, (4-butoxyphenyl)-, 4-butoxybenzeneboronic acid, 4-Butyloxyphenylboronic acid, N,N,N,N-TETRAAMYLETHYLENEDIAMINE