cas: 1350512-30-9 — see every product listed under this CAS number, including other names
(4-Chloro-2,5-dimethylphenyl)boronic acid, ≥95%, ≥95% (CAS 1350512-30-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K719-1g |
| cas | 1350512-30-9 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3587.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(4-chloro-2,5-dimethylphenyl)boronic acid (CAS 1350512-30-9) is a chemical compound with the molecular formula C8H10BClO2 and a molecular weight of 184.43 g/mol. IUPAC name: (4-chloro-2,5-dimethylphenyl)boronic acid. InChIKey: JPJIFQMIFNDDCU-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO2 |
|---|---|
| Molecular weight | 184.43 g/mol |
| IUPAC name | (4-chloro-2,5-dimethylphenyl)boronic acid |
| InChIKey | JPJIFQMIFNDDCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Cl)C)(O)O |
Computed by PubChem (NCBI)