cas: 944129-07-1 — see every product listed under this CAS number, including other names
(4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid, 95% (CAS 944129-07-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215966-250MG |
| cas | 944129-07-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 299.91 Pln | |
| Fluorochem | 10g | 476.93 Pln | |
| Fluorochem | 25g | 820.56 Pln | |
| Fluorochem | 100g | 1908.72 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 944129-07-1) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: GDJCQSNQOHRAGY-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | GDJCQSNQOHRAGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)OC)F)(O)O |
Computed by PubChem (NCBI)