Products 949892-09-5

CAS 949892-09-5 appears in our catalog under these names: (5-Chloro-4-fluoro-2-methoxyphenyl)boronic acid, 97%, (5-Chloro-4-fluoro-2-methoxyphenyl)boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

(5-chloro-4-fluoro-2-methoxyphenyl)boronic acid (CAS 949892-09-5) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (5-chloro-4-fluoro-2-methoxyphenyl)boronic acid. InChIKey: MROIVWKVBXFEMP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BClFO3
Molecular weight204.39 g/mol
IUPAC name(5-chloro-4-fluoro-2-methoxyphenyl)boronic acid
InChIKeyMROIVWKVBXFEMP-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1OC)F)Cl)(O)O

Computed by PubChem (NCBI)