CAS 944129-07-1 appears in our catalog under these names: 4-Chloro-2-fluoro-3-methoxyphenylboronic acid, 96%, (4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid 98%, 4-Chloro-2-fluoro-3-methoxyphenylboronic acid, 98%, 98%, (4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 25g, 50g, 100g.
(4-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 944129-07-1) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: GDJCQSNQOHRAGY-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | GDJCQSNQOHRAGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)OC)F)(O)O |
Computed by PubChem (NCBI)