CAS 1256355-46-0 appears in our catalog under these names: 2-Chloro-4-fluoro-5-methoxyphenylboronic acid, 98%, 2-Chloro-4-fluoro-5-methoxyphenylboronic acid, (2-Chloro-4-fluoro-5-methoxyphenyl)boronic acid 98%, 2-Chloro-4-fluoro-5-methoxyphenylboronic acid, 98%, 98%, (2-Chloro-4-fluoro-5-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg, 10g.
(2-chloro-4-fluoro-5-methoxyphenyl)boronic acid (CAS 1256355-46-0) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (2-chloro-4-fluoro-5-methoxyphenyl)boronic acid. InChIKey: KMSUZUNCVLTXJB-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (2-chloro-4-fluoro-5-methoxyphenyl)boronic acid |
| InChIKey | KMSUZUNCVLTXJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)F)OC)(O)O |
Computed by PubChem (NCBI)