CAS 2377610-22-3 is the registry number for 5-Chloro-2-fluoro-3-methoxyphenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
(5-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 2377610-22-3) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (5-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: NXBYANORDVFFMZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (5-chloro-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | NXBYANORDVFFMZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)OC)Cl)(O)O |
Computed by PubChem (NCBI)