Products 867333-04-8

CAS 867333-04-8 appears in our catalog under these names: 6-Chloro-2-fluoro-3-methoxyphenylboronic acid, 97%, (6-Chloro-2-fluoro-3-methoxyphenyl)boronic acid 98%, 6-Chloro-2-fluoro-3-methoxyphenylboronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 50mg, 250mg.

Structural formula: {0} (CAS {1})

(6-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 867333-04-8) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (6-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: CVKDGGIRBCXOSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BClFO3
Molecular weight204.39 g/mol
IUPAC name(6-chloro-2-fluoro-3-methoxyphenyl)boronic acid
InChIKeyCVKDGGIRBCXOSZ-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1F)OC)Cl)(O)O

Computed by PubChem (NCBI)