Products 2121513-76-4
CAS 2121513-76-4 appears in our catalog under these names: 3-Chloro-5-fluoro-2-methoxyphenylboronic acid, 98%, (3-Chloro-5-fluoro-2-methoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 100g, 1g, 10g, 250mg.
(3-chloro-5-fluoro-2-methoxyphenyl)boronic acid (CAS 2121513-76-4) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (3-chloro-5-fluoro-2-methoxyphenyl)boronic acid. InChIKey: FJDLPAVBXZISKS-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (3-chloro-5-fluoro-2-methoxyphenyl)boronic acid |
| InChIKey | FJDLPAVBXZISKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Cl)F)(O)O |
Computed by PubChem (NCBI)