(4-Chloro-2-fluoro-3-methylphenyl)boronic acid, 98%
cas: 944128-92-1 — see every product listed under this CAS number, including other names
(4-Chloro-2-fluoro-3-methylphenyl)boronic acid, 98% (CAS 944128-92-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F693979-1G |
| cas | 944128-92-1 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 898.81 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 2128.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4-chloro-2-fluoro-3-methylphenyl)boronic acid (CAS 944128-92-1) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (4-chloro-2-fluoro-3-methylphenyl)boronic acid. InChIKey: GEQUDJQVXRZIIK-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-methylphenyl)boronic acid |
| InChIKey | GEQUDJQVXRZIIK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)C)F)(O)O |
Computed by PubChem (NCBI)