(4-Chloro-2-fluoro-5-methylphenyl)boronic acid, 98%, 98%
cas: 325786-09-2 — see every product listed under this CAS number, including other names
(4-Chloro-2-fluoro-5-methylphenyl)boronic acid, 98%, 98% (CAS 325786-09-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118F0L-1g |
| cas | 325786-09-2 |
| size | 1g |
| availability | 3g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1106.00 Pln | |
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 669.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-chloro-2-fluoro-5-methylphenyl)boronic acid (CAS 325786-09-2) is a chemical compound with the molecular formula C7H7BClFO2 and a molecular weight of 188.39 g/mol. IUPAC name: (4-chloro-2-fluoro-5-methylphenyl)boronic acid. InChIKey: JCYUEORYFOUSCZ-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO2 |
|---|---|
| Molecular weight | 188.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-5-methylphenyl)boronic acid |
| InChIKey | JCYUEORYFOUSCZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Cl)C)(O)O |
Computed by PubChem (NCBI)