cas: 6966-45-6 — see every product listed under this CAS number, including other names
(4-Chloro-phenyl)-methanesulfonyl chloride, 97% (CAS 6966-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F020874-1G |
| cas | 6966-45-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4-chlorophenyl)methanesulfonyl chloride (CAS 6966-45-6) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: (4-chlorophenyl)methanesulfonyl chloride. InChIKey: DBJRPJSDYFDWPV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | (4-chlorophenyl)methanesulfonyl chloride |
| InChIKey | DBJRPJSDYFDWPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)