cas: 10547-60-1 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)(4-methoxyphenyl)methanone (CAS 10547-60-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1195S6-100mg |
| cas | 10547-60-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 798.80 Pln |
| delivery time | 3 weeks |
|---|
(4-chlorophenyl)-(4-methoxyphenyl)methanone (CAS 10547-60-1) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: (4-chlorophenyl)-(4-methoxyphenyl)methanone. InChIKey: JJVJYPSXZCEIEQ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | JJVJYPSXZCEIEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)