CAS 10547-60-1 appears in our catalog under these names: 4-Chloro-4'-methoxybenzophenone, 98%, Fenofibrate Impurity 7, (4-Chlorophenyl)(4-methoxyphenyl)methanone, 98%, (4–chlorophenyl)(4–methoxyphenyl)methanone, (4-Chlorophenyl)(4-methoxyphenyl)methanone. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, Chemat. Available pack sizes: 25g, 5g, 1g, on request, 100mg, 250mg.
(4-chlorophenyl)-(4-methoxyphenyl)methanone (CAS 10547-60-1) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: (4-chlorophenyl)-(4-methoxyphenyl)methanone. InChIKey: JJVJYPSXZCEIEQ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | JJVJYPSXZCEIEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)