cas: 10547-60-1 — see every product listed under this CAS number, including other names
4-Chloro-4'-methoxybenzophenone, 95% (CAS 10547-60-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022729-100MG |
| cas | 10547-60-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 539.41 Pln | |
| Fluorochem | 5g | 1294.35 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(4-chlorophenyl)-(4-methoxyphenyl)methanone (CAS 10547-60-1) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: (4-chlorophenyl)-(4-methoxyphenyl)methanone. InChIKey: JJVJYPSXZCEIEQ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | JJVJYPSXZCEIEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)