(4-Chlorophenyl)methanesulfonyl chloride 98%
cas: 6966-45-6 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)methanesulfonyl chloride 98% (CAS 6966-45-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469293-250mg |
| cas | 6966-45-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 770.88 Pln | |
| Ambeed | 25g | 2322.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A469293 |
(4-chlorophenyl)methanesulfonyl chloride (CAS 6966-45-6) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: (4-chlorophenyl)methanesulfonyl chloride. InChIKey: DBJRPJSDYFDWPV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | (4-chlorophenyl)methanesulfonyl chloride |
| InChIKey | DBJRPJSDYFDWPV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
(4-Chlorophenyl)methanesulfonyl chloride, 4-Chlorobenzylsulfonyl chloride, (4-Chloro-phenyl)-methanesulfonyl chloride, (4-chlorophenyl)methanesulphonyl chloride, 4-Chlorobenzylsulfonyl chloride, 97%, 4-chloro-alpha-toluenesulfonyl chloride, (4-chloro-phenyl)methanesulfonyl chloride, (4-Chlorophenyl)-methanesulfonyl chloride, [(4-chlorophenyl)methyl]sulfonyl chloride, chloro[(4-chlorophenyl)methyl]sulfone