(4-Ethoxy-2-(trifluoromethyl)phenyl)boronic acid, 98%
cas: 313545-39-0 — see every product listed under this CAS number, including other names
(4-Ethoxy-2-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 313545-39-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A142585-250mg |
| cas | 313545-39-0 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 154.63 Pln | |
| AmBeed | 1g | 317.38 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 763.29 Pln | |
| Fluorochem | 10g | 1315.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-ethoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 313545-39-0) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [4-ethoxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: OGQUWAGSWMWDRG-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [4-ethoxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | OGQUWAGSWMWDRG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)