cas: 643093-74-7 — see every product listed under this CAS number, including other names
(4-Formyl-2,3-dimethylphenyl)boronic acid, 95+% (CAS 643093-74-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A661666-10g |
| cas | 643093-74-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 11833.57 Pln | |
| AmBeed | 25g | 23173.99 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-formyl-2,3-dimethylphenyl)boronic acid (CAS 643093-74-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,3-dimethylphenyl)boronic acid. InChIKey: VWKSRDYVNJKHOI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,3-dimethylphenyl)boronic acid |
| InChIKey | VWKSRDYVNJKHOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)C)C)(O)O |
Computed by PubChem (NCBI)