cas: 643093-74-7 — see every product listed under this CAS number, including other names
2,3-Dimethyl-4-formylphenylboronic acid, 95%, 95% (CAS 643093-74-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKXP-100mg |
| cas | 643093-74-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1302.80 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-formyl-2,3-dimethylphenyl)boronic acid (CAS 643093-74-7) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-2,3-dimethylphenyl)boronic acid. InChIKey: VWKSRDYVNJKHOI-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-2,3-dimethylphenyl)boronic acid |
| InChIKey | VWKSRDYVNJKHOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C=O)C)C)(O)O |
Computed by PubChem (NCBI)