CAS 1218790-71-6 appears in our catalog under these names: 4-Formyl-3,5-dimethylphenylboronic acid, 97%, 4-Formyl-3,5-dimethylphenylboronic acid, 97%, 97%, (4-Formyl-3,5-dimethylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg.
(4-formyl-3,5-dimethylphenyl)boronic acid (CAS 1218790-71-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-3,5-dimethylphenyl)boronic acid. InChIKey: HMOKNSHYDFAZAZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-3,5-dimethylphenyl)boronic acid |
| InChIKey | HMOKNSHYDFAZAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C=O)C)(O)O |
Computed by PubChem (NCBI)