cas: 1218790-71-6 — see every product listed under this CAS number, including other names
(4-Formyl-3,5-dimethylphenyl)boronic acid 97% (CAS 1218790-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A532498-100mg |
| cas | 1218790-71-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2061.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A532498 |
(4-formyl-3,5-dimethylphenyl)boronic acid (CAS 1218790-71-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-3,5-dimethylphenyl)boronic acid. InChIKey: HMOKNSHYDFAZAZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-3,5-dimethylphenyl)boronic acid |
| InChIKey | HMOKNSHYDFAZAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C=O)C)(O)O |
Computed by PubChem (NCBI)