(4-Methyl-2-(trifluoromethyl)phenyl)boronic acid, 98%
cas: 1021860-94-5 — see every product listed under this CAS number, including other names
(4-Methyl-2-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 1021860-94-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A100019-250mg |
| cas | 1021860-94-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2200.44 Pln | |
| Ambeed | 25g | 7785.19 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 692.00 Pln | |
| BLDpharm | 5g | 2369.19 Pln | |
| BLDpharm | 25g | 8389.29 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Fluorochem | 5g | 2267.97 Pln | |
| Fluorochem | 10g | 4131.90 Pln | |
| Fluorochem | 25g | 7818.10 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-methyl-2-(trifluoromethyl)phenyl]boronic acid (CAS 1021860-94-5) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [4-methyl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: KDOJXIIVCMNOSQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [4-methyl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | KDOJXIIVCMNOSQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Methyl-2-(trifluoromethyl)phenyl)boronic acid, [4-methyl-2-(trifluoromethyl)phenyl]boronic acid, 4-Methyl-2-(trifluoromethyl)phenylboronic acid, Boronic acid, B-[4-methyl-2-(trifluoromethyl)phenyl]-, 4-Methyl-2-trifluoromethyl-phenylboronic acid, 4-methyl-2-trifluoromethylphenylboronic acid, (4-methyl-2-(trifluoromethyl)phenyl) boronic acid