cas: 1021860-94-5 — see every product listed under this CAS number, including other names
4-Methyl-2-(trifluoromethyl)phenylboronic acid, 98%, 98% (CAS 1021860-94-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1117TP-10g |
| cas | 1021860-94-5 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 3309.20 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 549.20 Pln | |
| Chemat | 5g | 1840.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-methyl-2-(trifluoromethyl)phenyl]boronic acid (CAS 1021860-94-5) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [4-methyl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: KDOJXIIVCMNOSQ-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [4-methyl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | KDOJXIIVCMNOSQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)