(4-Nitrophenyl)boronic acid, 97%, 97%
cas: 24067-17-2 — see every product listed under this CAS number, including other names
(4-Nitrophenyl)boronic acid, 97%, 97% (CAS 24067-17-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LWB-250mg |
| cas | 24067-17-2 |
| size | 250mg |
| availability | 5000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 400.40 Pln | |
| Chemat | 100g | 1346.00 Pln | |
| Chemat | 50g | 722.00 Pln | |
| Chemat | 1kg | 6376.40 Pln | |
| Chemat | 5kg | 28968.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-nitrophenyl)boronic acid (CAS 24067-17-2) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: (4-nitrophenyl)boronic acid. InChIKey: NSFJAFZHYOAMHL-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | (4-nitrophenyl)boronic acid |
| InChIKey | NSFJAFZHYOAMHL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)