CAS 13331-27-6 appears in our catalog under these names: 3-Nitrophenylboronic Acid, m-Nitrophenylboronic acidm-Nitrophenylboronic acid, >97%, 3–Nitrophenylboronic acid(contains varying amounts of Anhydride), 3–Nitrophenylboronic acid, 3-Nitrobenzeneboronic acid, 98% . Offered by: TRC, Lumtec, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 5g, On request, 10g, 100g, 500g, 1kg.
(3-nitrophenyl)boronic acid (CAS 13331-27-6) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: (3-nitrophenyl)boronic acid. InChIKey: ZNRGSYUVFVNSAW-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | (3-nitrophenyl)boronic acid |
| InChIKey | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)