CAS 913836-11-0 appears in our catalog under these names: 5-Boronopicolinic acid, 98%, 5-Boronopicolinic Acid, 5-boronopicolinic acid, 95%, 95%, 5-Boronopicolinic acid, 95%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10mg, 5mg, 100mg, 500mg.
5-boronopyridine-2-carboxylic acid (CAS 913836-11-0) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: 5-boronopyridine-2-carboxylic acid. InChIKey: UEKWXZLQKGKCEQ-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | 5-boronopyridine-2-carboxylic acid |
| InChIKey | UEKWXZLQKGKCEQ-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)