CAS 1072946-05-4 appears in our catalog under these names: 3-Boronoisonicotinic acid, 90%, 3-Boronoisonicotinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
3-boronopyridine-4-carboxylic acid (CAS 1072946-05-4) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: 3-boronopyridine-4-carboxylic acid. InChIKey: NHHWTGRSSOPFSI-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | 3-boronopyridine-4-carboxylic acid |
| InChIKey | NHHWTGRSSOPFSI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)