Products 1019767-68-0
CAS 1019767-68-0 appears in our catalog under these names: [1,3]Dioxolo[4,5-b]pyridin-6-ylboronic acid 98%, [1,3]Dioxolo[4,5-b]pyridin-6-ylboronic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[1,3]dioxolo[4,5-b]pyridin-6-ylboronic acid (CAS 1019767-68-0) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: [1,3]dioxolo[4,5-b]pyridin-6-ylboronic acid. InChIKey: BLIORSSNVQRHBR-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | [1,3]dioxolo[4,5-b]pyridin-6-ylboronic acid |
| InChIKey | BLIORSSNVQRHBR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N=C1)OCO2)(O)O |
Computed by PubChem (NCBI)