CAS 24067-17-2 appears in our catalog under these names: 4–Nitrobenzeneboronic Acid, 4-Nitrobenzeneboronic acid, 95% , 4-Nitrophenylboronic Acid (contains varying amounts of Anhydride), 4-Nitrophenylboronic acid, 4-Nitrophenylboronic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 5g, 50g, 100g, 250mg, 25g, 1kg.
(4-nitrophenyl)boronic acid (CAS 24067-17-2) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: (4-nitrophenyl)boronic acid. InChIKey: NSFJAFZHYOAMHL-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | (4-nitrophenyl)boronic acid |
| InChIKey | NSFJAFZHYOAMHL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)