CAS 1072946-59-8 appears in our catalog under these names: 2-Carboxypyridine-4-boronic acid, 98%, 4-Boronopicolinic acid, 98%, 2-Carboxypyridine-4-boronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 0,05g, 0,1g, 0,25g.
4-boronopyridine-2-carboxylic acid (CAS 1072946-59-8) is a chemical compound with the molecular formula C6H6BNO4 and a molecular weight of 166.93 g/mol. IUPAC name: 4-boronopyridine-2-carboxylic acid. InChIKey: JWKBLCPJNBCIIR-UHFFFAOYSA-N.
| Molecular formula | C6H6BNO4 |
|---|---|
| Molecular weight | 166.93 g/mol |
| IUPAC name | 4-boronopyridine-2-carboxylic acid |
| InChIKey | JWKBLCPJNBCIIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)C(=O)O)(O)O |
Computed by PubChem (NCBI)