cas: 556-10-5 — see every product listed under this CAS number, including other names
(4-Nitrophenyl)urea, >98.0%(HPLC)(N) (CAS 556-10-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0980-1G |
| cas | 556-10-5 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 546.15 Pln | |
| TCI | 5g | 2070.49 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
(4-nitrophenyl)urea (CAS 556-10-5) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (4-nitrophenyl)urea. InChIKey: LXXTVGKSGJADFU-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (4-nitrophenyl)urea |
| InChIKey | LXXTVGKSGJADFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)