1-(4-Nitrophenyl)urea, 98%
cas: 556-10-5 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)urea, 98% (CAS 556-10-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A342351-250mg |
| cas | 556-10-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 832.06 Pln | |
| Ambeed | 10g | 1405.00 Pln | |
| Ambeed | 25g | 2756.69 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 325.47 Pln | |
| BLDpharm | 5g | 891.93 Pln | |
| BLDpharm | 10g | 1508.38 Pln | |
| BLDpharm | 25g | 2968.98 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 1029.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-nitrophenyl)urea (CAS 556-10-5) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: (4-nitrophenyl)urea. InChIKey: LXXTVGKSGJADFU-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (4-nitrophenyl)urea |
| InChIKey | LXXTVGKSGJADFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)
