cas: 38107-10-7 — see every product listed under this CAS number, including other names
(4-Phenyl-thiazol-2-yl)-acetic acid, ≥97%, ≥97% (CAS 38107-10-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYWI-50mg |
| cas | 38107-10-7 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 222.80 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1571.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
2-(4-phenyl-1,3-thiazol-2-yl)acetic acid (CAS 38107-10-7) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-(4-phenyl-1,3-thiazol-2-yl)acetic acid. InChIKey: OLQHHTZTEVMZLC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-(4-phenyl-1,3-thiazol-2-yl)acetic acid |
| InChIKey | OLQHHTZTEVMZLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CC(=O)O |
Computed by PubChem (NCBI)