Products 38107-10-7
CAS 38107-10-7 appears in our catalog under these names: (4-Phenyl-thiazol-2-yl)-acetic acid, 95%, (4-Phenyl-thiazol-2-yl)-acetic acid, ≥97%, ≥97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 50mg.
2-(4-phenyl-1,3-thiazol-2-yl)acetic acid (CAS 38107-10-7) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-(4-phenyl-1,3-thiazol-2-yl)acetic acid. InChIKey: OLQHHTZTEVMZLC-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-(4-phenyl-1,3-thiazol-2-yl)acetic acid |
| InChIKey | OLQHHTZTEVMZLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)CC(=O)O |
Computed by PubChem (NCBI)